C30H28N4O3 — CID 3315149
1-(2,3-dimethylphenyl)-4-[4-(3,4-dimethylpyridin-1-ium-1-yl)-2,5-dioxo-1-phenylpyrrol-3-yl]-3-ethylpyrazol-5-olate (PubChem CID 3315149) has the molecular formula C30H28N4O3 and a molecular weight of 492.58 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-4-[4-(3,4-dimethylpyridin-1-ium-1-yl)-2,5-dioxo-1-phenylpyrrol-3-yl]-3-ethylpyrazol-5-olate.
| Compound Name | 1-(2,3-dimethylphenyl)-4-[4-(3,4-dimethylpyridin-1-ium-1-yl)-2,5-dioxo-1-phenylpyrrol-3-yl]-3-ethylpyrazol-5-olate |
|---|---|
| PubChem CID | 3315149 |
| Molecular Formula | C30H28N4O3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-4-[4-(3,4-dimethylpyridin-1-ium-1-yl)-2,5-dioxo-1-phenylpyrrol-3-yl]-3-ethylpyrazol-5-olate |
| SMILES | CCc1nn(-c2cccc(C)c2C)c([O-])c1C1=C([n+]2ccc(C)c(C)c2)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C30H28N4O3/c1-6-23-25(29(36)34(31-23)24-14-10-11-19(3)21(24)5)26-27(32-16-15-18(2)20(4)17-32)30(37)33(28(26)35)22-12-8-7-9-13-22/h7-17H,6H2,1-5H3 |
| InChIKey | PZSAVHOENAWPTD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|