C24H23ClN4O3 — CID 4262443
1-(3-chlorophenyl)-4-[4-(3,4-dimethylpyridin-1-ium-1-yl)-2,5-dioxo-1-propylpyrrol-3-yl]-3-methylpyrazol-5-olate (PubChem CID 4262443) has the molecular formula C24H23ClN4O3 and a molecular weight of 450.93 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[4-(3,4-dimethylpyridin-1-ium-1-yl)-2,5-dioxo-1-propylpyrrol-3-yl]-3-methylpyrazol-5-olate.
| Compound Name | 1-(3-chlorophenyl)-4-[4-(3,4-dimethylpyridin-1-ium-1-yl)-2,5-dioxo-1-propylpyrrol-3-yl]-3-methylpyrazol-5-olate |
|---|---|
| PubChem CID | 4262443 |
| Molecular Formula | C24H23ClN4O3 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[4-(3,4-dimethylpyridin-1-ium-1-yl)-2,5-dioxo-1-propylpyrrol-3-yl]-3-methylpyrazol-5-olate |
| SMILES | CCCN1C(=O)C(c2c(C)nn(-c3cccc(Cl)c3)c2[O-])=C([n+]2ccc(C)c(C)c2)C1=O |
| InChI | InChI=1S/C24H23ClN4O3/c1-5-10-28-22(30)20(21(24(28)32)27-11-9-14(2)15(3)13-27)19-16(4)26-29(23(19)31)18-8-6-7-17(25)12-18/h6-9,11-13H,5,10H2,1-4H3 |
| InChIKey | JOMXUAVLYCCEDG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|