C20H13Cl2F3N2O3S — CID 3439145
4-chloro-3-[(4-chlorophenyl)-methylsulfamoyl]-N-(2,3,4-trifluorophenyl)benzamide (PubChem CID 3439145) has the molecular formula C20H13Cl2F3N2O3S and a molecular weight of 489.30 g/mol. Its IUPAC name is 4-chloro-3-[(4-chlorophenyl)-methylsulfamoyl]-N-(2,3,4-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[(4-chlorophenyl)-methylsulfamoyl]-N-(2,3,4-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 3439145 |
| Molecular Formula | C20H13Cl2F3N2O3S |
| Molecular Weight | 489.30 g/mol |
| Exact Mass | 488.00 |
| IUPAC Name | 4-chloro-3-[(4-chlorophenyl)-methylsulfamoyl]-N-(2,3,4-trifluorophenyl)benzamide |
| SMILES | CN(c1ccc(Cl)cc1)S(=O)(=O)c1cc(C(=O)Nc2ccc(F)c(F)c2F)ccc1Cl |
| InChI | InChI=1S/C20H13Cl2F3N2O3S/c1-27(13-5-3-12(21)4-6-13)31(29,30)17-10-11(2-7-14(17)22)20(28)26-16-9-8-15(23)18(24)19(16)25/h2-10H,1H3,(H,26,28) |
| InChIKey | RTZXERVQYAXAEG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.30 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|