C16H16N2O — CID 3439581
N-(4,6-dimethyl-2-pyridinyl)-3-phenylprop-2-enamide (PubChem CID 3439581) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)-3-phenylprop-2-enamide.
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 3439581 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)-3-phenylprop-2-enamide |
| SMILES | Cc1cc(C)nc(NC(=O)C=Cc2ccccc2)c1 |
| InChI | InChI=1S/C16H16N2O/c1-12-10-13(2)17-15(11-12)18-16(19)9-8-14-6-4-3-5-7-14/h3-11H,1-2H3,(H,17,18,19) |
| InChIKey | OTDZQCNOCJWAHP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|