C22H22ClN3O4 — CID 34415892
(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl 2-[(2-ethoxybenzoyl)amino]acetate (PubChem CID 34415892) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is (5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl 2-[(2-ethoxybenzoyl)amino]acetate.
| Compound Name | (5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl 2-[(2-ethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 34415892 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | (5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl 2-[(2-ethoxybenzoyl)amino]acetate |
| SMILES | CCOc1ccccc1C(=O)NCC(=O)OCc1c(C)nn(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C22H22ClN3O4/c1-3-29-19-12-8-7-11-17(19)22(28)24-13-20(27)30-14-18-15(2)25-26(21(18)23)16-9-5-4-6-10-16/h4-12H,3,13-14H2,1-2H3,(H,24,28) |
| InChIKey | SHNKGYRONKHXSU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |