C25H30N4O3 — CID 34430651
2-ethoxy-N-[4-[[2-[(4-ethylphenyl)methyl]pyrazol-3-yl]amino]-4-oxobutyl]benzamide (PubChem CID 34430651) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-ethoxy-N-[4-[[2-[(4-ethylphenyl)methyl]pyrazol-3-yl]amino]-4-oxobutyl]benzamide.
| Compound Name | 2-ethoxy-N-[4-[[2-[(4-ethylphenyl)methyl]pyrazol-3-yl]amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 34430651 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 2-ethoxy-N-[4-[[2-[(4-ethylphenyl)methyl]pyrazol-3-yl]amino]-4-oxobutyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)NCCCC(=O)Nc1ccnn1Cc1ccc(CC)cc1 |
| InChI | InChI=1S/C25H30N4O3/c1-3-19-11-13-20(14-12-19)18-29-23(15-17-27-29)28-24(30)10-7-16-26-25(31)21-8-5-6-9-22(21)32-4-2/h5-6,8-9,11-15,17H,3-4,7,10,16,18H2,1-2H3,(H,26,31)(H,28,30) |
| InChIKey | JTGGZJDOMOZVHL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|