C21H18N2O2S — CID 3446223
5-(2,5-dimethylanilino)-3-naphthalen-1-yl-1,3-thiazolidine-2,4-dione (PubChem CID 3446223) has the molecular formula C21H18N2O2S and a molecular weight of 362.45 g/mol. Its IUPAC name is 5-(2,5-dimethylanilino)-3-naphthalen-1-yl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-(2,5-dimethylanilino)-3-naphthalen-1-yl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3446223 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 5-(2,5-dimethylanilino)-3-naphthalen-1-yl-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(C)c(NC2SC(=O)N(c3cccc4ccccc34)C2=O)c1 |
| InChI | InChI=1S/C21H18N2O2S/c1-13-10-11-14(2)17(12-13)22-19-20(24)23(21(25)26-19)18-9-5-7-15-6-3-4-8-16(15)18/h3-12,19,22H,1-2H3 |
| InChIKey | IROFMENKCNYLKO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|