C22H33N3O3S2 — CID 3449273
N-cyclopropyl-2-[5-hydroxy-4,8a-dimethyl-2-[(2-methylsulfanylacetyl)amino]-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]propanamide (PubChem CID 3449273) has the molecular formula C22H33N3O3S2 and a molecular weight of 451.66 g/mol. Its IUPAC name is N-cyclopropyl-2-[5-hydroxy-4,8a-dimethyl-2-[(2-methylsulfanylacetyl)amino]-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]propanamide.
| Compound Name | N-cyclopropyl-2-[5-hydroxy-4,8a-dimethyl-2-[(2-methylsulfanylacetyl)amino]-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]propanamide |
|---|---|
| PubChem CID | 3449273 |
| Molecular Formula | C22H33N3O3S2 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | N-cyclopropyl-2-[5-hydroxy-4,8a-dimethyl-2-[(2-methylsulfanylacetyl)amino]-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]propanamide |
| SMILES | CSCC(=O)Nc1nc2c(s1)CC1(C)CCC(C(C)C(=O)NC3CC3)C(O)C1C2C |
| InChI | InChI=1S/C22H33N3O3S2/c1-11(20(28)23-13-5-6-13)14-7-8-22(3)9-15-18(12(2)17(22)19(14)27)25-21(30-15)24-16(26)10-29-4/h11-14,17,19,27H,5-10H2,1-4H3,(H,23,28)(H,24,25,26) |
| InChIKey | IAVZUSMVEGDFAA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |