C23H35N3O3S2 — CID 3859242
2-[5-hydroxy-4,8a-dimethyl-2-[(2-methylsulfanylacetyl)amino]-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-methyl-N-prop-2-enylpropanamide (PubChem CID 3859242) has the molecular formula C23H35N3O3S2 and a molecular weight of 465.69 g/mol. Its IUPAC name is 2-[5-hydroxy-4,8a-dimethyl-2-[(2-methylsulfanylacetyl)amino]-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-methyl-N-prop-2-enylpropanamide.
| Compound Name | 2-[5-hydroxy-4,8a-dimethyl-2-[(2-methylsulfanylacetyl)amino]-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-methyl-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 3859242 |
| Molecular Formula | C23H35N3O3S2 |
| Molecular Weight | 465.69 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 2-[5-hydroxy-4,8a-dimethyl-2-[(2-methylsulfanylacetyl)amino]-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-methyl-N-prop-2-enylpropanamide |
| SMILES | C=CCN(C)C(=O)C(C)C1CCC2(C)Cc3sc(NC(=O)CSC)nc3C(C)C2C1O |
| InChI | InChI=1S/C23H35N3O3S2/c1-7-10-26(5)21(29)13(2)15-8-9-23(4)11-16-19(14(3)18(23)20(15)28)25-22(31-16)24-17(27)12-30-6/h7,13-15,18,20,28H,1,8-12H2,2-6H3,(H,24,25,27) |
| InChIKey | MFRFSPBNEUBNAC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.69 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|