C24H23FN2O3S — CID 3449899
methyl 4-[[2-[(3-fluorophenyl)methylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]benzoate (PubChem CID 3449899) has the molecular formula C24H23FN2O3S and a molecular weight of 438.52 g/mol. Its IUPAC name is methyl 4-[[2-[(3-fluorophenyl)methylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(3-fluorophenyl)methylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 3449899 |
| Molecular Formula | C24H23FN2O3S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | methyl 4-[[2-[(3-fluorophenyl)methylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2c(NCc3cccc(F)c3)sc3c2CCCC3)cc1 |
| InChI | InChI=1S/C24H23FN2O3S/c1-30-24(29)16-9-11-18(12-10-16)27-22(28)21-19-7-2-3-8-20(19)31-23(21)26-14-15-5-4-6-17(25)13-15/h4-6,9-13,26H,2-3,7-8,14H2,1H3,(H,27,28) |
| InChIKey | VIKBJKCBQVAVGS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_H(2)', 'substructure': 'N/A'} |
|---|