C24H26N4O3S2 — CID 34512877
4-[[5-(3,4-dimethoxyphenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-phenyl-1,3-thiazole (PubChem CID 34512877) has the molecular formula C24H26N4O3S2 and a molecular weight of 482.63 g/mol. Its IUPAC name is 4-[[5-(3,4-dimethoxyphenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-phenyl-1,3-thiazole.
| Compound Name | 4-[[5-(3,4-dimethoxyphenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 34512877 |
| Molecular Formula | C24H26N4O3S2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 4-[[5-(3,4-dimethoxyphenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-phenyl-1,3-thiazole |
| SMILES | COCCCn1c(SCc2csc(-c3ccccc3)n2)nnc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H26N4O3S2/c1-29-13-7-12-28-22(18-10-11-20(30-2)21(14-18)31-3)26-27-24(28)33-16-19-15-32-23(25-19)17-8-5-4-6-9-17/h4-6,8-11,14-15H,7,12-13,16H2,1-3H3 |
| InChIKey | LOSUJQJGOLJPGR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|