C15H21N3O3S — CID 60608081
3-(3,4-dimethoxyphenyl)-4-(3-methoxypropyl)-5-methylsulfanyl-1,2,4-triazole (PubChem CID 60608081) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-4-(3-methoxypropyl)-5-methylsulfanyl-1,2,4-triazole.
| Compound Name | 3-(3,4-dimethoxyphenyl)-4-(3-methoxypropyl)-5-methylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 60608081 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-4-(3-methoxypropyl)-5-methylsulfanyl-1,2,4-triazole |
| SMILES | COCCCn1c(SC)nnc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H21N3O3S/c1-19-9-5-8-18-14(16-17-15(18)22-4)11-6-7-12(20-2)13(10-11)21-3/h6-7,10H,5,8-9H2,1-4H3 |
| InChIKey | GQKVLBUADZLNGD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|