C24H36N4O4S — CID 46606585
N-cyclohexyl-2-[[5-(3,4-dimethoxyphenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-methylpropanamide (PubChem CID 46606585) has the molecular formula C24H36N4O4S and a molecular weight of 476.64 g/mol. Its IUPAC name is N-cyclohexyl-2-[[5-(3,4-dimethoxyphenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-methylpropanamide.
| Compound Name | N-cyclohexyl-2-[[5-(3,4-dimethoxyphenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 46606585 |
| Molecular Formula | C24H36N4O4S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | N-cyclohexyl-2-[[5-(3,4-dimethoxyphenyl)-4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-methylpropanamide |
| SMILES | COCCCn1c(SC(C)C(=O)N(C)C2CCCCC2)nnc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H36N4O4S/c1-17(23(29)27(2)19-10-7-6-8-11-19)33-24-26-25-22(28(24)14-9-15-30-3)18-12-13-20(31-4)21(16-18)32-5/h12-13,16-17,19H,6-11,14-15H2,1-5H3 |
| InChIKey | BCLCKTAOVWEJBS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|