C29H27FN4O — CID 3452300
[4-(5-benzyl-6-methyl-2-phenylpyrimidin-4-yl)piperazin-1-yl]-(2-fluorophenyl)methanone (PubChem CID 3452300) has the molecular formula C29H27FN4O and a molecular weight of 466.56 g/mol. Its IUPAC name is [4-(5-benzyl-6-methyl-2-phenylpyrimidin-4-yl)piperazin-1-yl]-(2-fluorophenyl)methanone.
| Compound Name | [4-(5-benzyl-6-methyl-2-phenylpyrimidin-4-yl)piperazin-1-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 3452300 |
| Molecular Formula | C29H27FN4O |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | [4-(5-benzyl-6-methyl-2-phenylpyrimidin-4-yl)piperazin-1-yl]-(2-fluorophenyl)methanone |
| SMILES | Cc1nc(-c2ccccc2)nc(N2CCN(C(=O)c3ccccc3F)CC2)c1Cc1ccccc1 |
| InChI | InChI=1S/C29H27FN4O/c1-21-25(20-22-10-4-2-5-11-22)28(32-27(31-21)23-12-6-3-7-13-23)33-16-18-34(19-17-33)29(35)24-14-8-9-15-26(24)30/h2-15H,16-20H2,1H3 |
| InChIKey | SLBZNODAXAEUQN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |