C31H29ClN4O — CID 42665262
(E)-1-[4-[5-[(4-chlorophenyl)methyl]-6-methyl-2-phenylpyrimidin-4-yl]piperazin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 42665262) has the molecular formula C31H29ClN4O and a molecular weight of 509.05 g/mol. Its IUPAC name is (E)-1-[4-[5-[(4-chlorophenyl)methyl]-6-methyl-2-phenylpyrimidin-4-yl]piperazin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[5-[(4-chlorophenyl)methyl]-6-methyl-2-phenylpyrimidin-4-yl]piperazin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 42665262 |
| Molecular Formula | C31H29ClN4O |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | (E)-1-[4-[5-[(4-chlorophenyl)methyl]-6-methyl-2-phenylpyrimidin-4-yl]piperazin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | Cc1nc(-c2ccccc2)nc(N2CCN(C(=O)/C=C/c3ccccc3)CC2)c1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H29ClN4O/c1-23-28(22-25-12-15-27(32)16-13-25)31(34-30(33-23)26-10-6-3-7-11-26)36-20-18-35(19-21-36)29(37)17-14-24-8-4-2-5-9-24/h2-17H,18-22H2,1H3/b17-14+ |
| InChIKey | CHNAGJSLZDOYIL-SAPNQHFASA-N |
| XLogP | 6.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|