C27H28ClN5O3 — CID 1029547
(E)-1-[4-[5-[(4-chlorophenyl)methyl]-6-ethyl-2-methylpyrimidin-4-yl]piperazin-1-yl]-3-(4-nitrophenyl)prop-2-en-1-one (PubChem CID 1029547) has the molecular formula C27H28ClN5O3 and a molecular weight of 506.01 g/mol. Its IUPAC name is (E)-1-[4-[5-[(4-chlorophenyl)methyl]-6-ethyl-2-methylpyrimidin-4-yl]piperazin-1-yl]-3-(4-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[5-[(4-chlorophenyl)methyl]-6-ethyl-2-methylpyrimidin-4-yl]piperazin-1-yl]-3-(4-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 1029547 |
| Molecular Formula | C27H28ClN5O3 |
| Molecular Weight | 506.01 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | (E)-1-[4-[5-[(4-chlorophenyl)methyl]-6-ethyl-2-methylpyrimidin-4-yl]piperazin-1-yl]-3-(4-nitrophenyl)prop-2-en-1-one |
| SMILES | CCc1nc(C)nc(N2CCN(C(=O)/C=C/c3ccc([N+](=O)[O-])cc3)CC2)c1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H28ClN5O3/c1-3-25-24(18-21-4-9-22(28)10-5-21)27(30-19(2)29-25)32-16-14-31(15-17-32)26(34)13-8-20-6-11-23(12-7-20)33(35)36/h4-13H,3,14-18H2,1-2H3/b13-8+ |
| InChIKey | UBLONNMCINVGBH-MDWZMJQESA-N |
| XLogP | 4.86 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.01 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|