C28H32ClN5O3 — CID 83282911
(2-chlorophenyl)-[4-[6-ethyl-2-(2-methylpropyl)-5-[(4-nitrophenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 83282911) has the molecular formula C28H32ClN5O3 and a molecular weight of 522.05 g/mol. Its IUPAC name is (2-chlorophenyl)-[4-[6-ethyl-2-(2-methylpropyl)-5-[(4-nitrophenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | (2-chlorophenyl)-[4-[6-ethyl-2-(2-methylpropyl)-5-[(4-nitrophenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 83282911 |
| Molecular Formula | C28H32ClN5O3 |
| Molecular Weight | 522.05 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | (2-chlorophenyl)-[4-[6-ethyl-2-(2-methylpropyl)-5-[(4-nitrophenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | CCc1nc(CC(C)C)nc(N2CCN(C(=O)c3ccccc3Cl)CC2)c1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H32ClN5O3/c1-4-25-23(18-20-9-11-21(12-10-20)34(36)37)27(31-26(30-25)17-19(2)3)32-13-15-33(16-14-32)28(35)22-7-5-6-8-24(22)29/h5-12,19H,4,13-18H2,1-3H3 |
| InChIKey | WAUQVDPSLMRSDN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.05 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|