C25H24N2O3 — CID 34543248
4-[(2-benzo[e][1]benzofuran-1-ylacetyl)amino]-N,N-diethylbenzamide (PubChem CID 34543248) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 4-[(2-benzo[e][1]benzofuran-1-ylacetyl)amino]-N,N-diethylbenzamide.
| Compound Name | 4-[(2-benzo[e][1]benzofuran-1-ylacetyl)amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 34543248 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 4-[(2-benzo[e][1]benzofuran-1-ylacetyl)amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)Cc2coc3ccc4ccccc4c23)cc1 |
| InChI | InChI=1S/C25H24N2O3/c1-3-27(4-2)25(29)18-9-12-20(13-10-18)26-23(28)15-19-16-30-22-14-11-17-7-5-6-8-21(17)24(19)22/h5-14,16H,3-4,15H2,1-2H3,(H,26,28) |
| InChIKey | ABRPOXFGXOVJNO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |