C21H15F2NO2S — CID 4728274
2-benzo[e][1]benzofuran-1-yl-N-[4-(difluoromethylsulfanyl)phenyl]acetamide (PubChem CID 4728274) has the molecular formula C21H15F2NO2S and a molecular weight of 383.42 g/mol. Its IUPAC name is 2-benzo[e][1]benzofuran-1-yl-N-[4-(difluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-benzo[e][1]benzofuran-1-yl-N-[4-(difluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4728274 |
| Molecular Formula | C21H15F2NO2S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2-benzo[e][1]benzofuran-1-yl-N-[4-(difluoromethylsulfanyl)phenyl]acetamide |
| SMILES | O=C(Cc1coc2ccc3ccccc3c12)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C21H15F2NO2S/c22-21(23)27-16-8-6-15(7-9-16)24-19(25)11-14-12-26-18-10-5-13-3-1-2-4-17(13)20(14)18/h1-10,12,21H,11H2,(H,24,25) |
| InChIKey | QAYYBQFVHHXGFW-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |