C19H24N4O2 — CID 3454989
ethenyl 4-[(1-benzylimidazol-2-yl)methyl]-1,4-diazepane-1-carboxylate (PubChem CID 3454989) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is ethenyl 4-[(1-benzylimidazol-2-yl)methyl]-1,4-diazepane-1-carboxylate.
| Compound Name | ethenyl 4-[(1-benzylimidazol-2-yl)methyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 3454989 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | ethenyl 4-[(1-benzylimidazol-2-yl)methyl]-1,4-diazepane-1-carboxylate |
| SMILES | C=COC(=O)N1CCCN(Cc2nccn2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H24N4O2/c1-2-25-19(24)22-11-6-10-21(13-14-22)16-18-20-9-12-23(18)15-17-7-4-3-5-8-17/h2-5,7-9,12H,1,6,10-11,13-16H2 |
| InChIKey | IHRYJZMBQVHERL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|