C26H29NO6S — CID 3455673
2-[2-(3-benzyl-4,8-dimethyl-2-oxochromen-7-yl)oxypropanoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 3455673) has the molecular formula C26H29NO6S and a molecular weight of 483.59 g/mol. Its IUPAC name is 2-[2-(3-benzyl-4,8-dimethyl-2-oxochromen-7-yl)oxypropanoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[2-(3-benzyl-4,8-dimethyl-2-oxochromen-7-yl)oxypropanoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 3455673 |
| Molecular Formula | C26H29NO6S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 2-[2-(3-benzyl-4,8-dimethyl-2-oxochromen-7-yl)oxypropanoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(C)Oc1ccc2c(C)c(Cc3ccccc3)c(=O)oc2c1C)C(=O)O |
| InChI | InChI=1S/C26H29NO6S/c1-15-19-10-11-22(32-17(3)24(28)27-21(25(29)30)12-13-34-4)16(2)23(19)33-26(31)20(15)14-18-8-6-5-7-9-18/h5-11,17,21H,12-14H2,1-4H3,(H,27,28)(H,29,30) |
| InChIKey | FOSNWSBVIHEWAE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|