C20H23N3O3S — CID 34565384
N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]-1H-indole-2-carboxamide (PubChem CID 34565384) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]-1H-indole-2-carboxamide.
| Compound Name | N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 34565384 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]-1H-indole-2-carboxamide |
| SMILES | CC(C)NS(=O)(=O)Cc1ccccc1CNC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H23N3O3S/c1-14(2)23-27(25,26)13-17-9-4-3-8-16(17)12-21-20(24)19-11-15-7-5-6-10-18(15)22-19/h3-11,14,22-23H,12-13H2,1-2H3,(H,21,24) |
| InChIKey | MFPCPUWBADLJQN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |