C21H22N2O5S — CID 18121330
2-oxo-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]chromene-3-carboxamide (PubChem CID 18121330) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is 2-oxo-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]chromene-3-carboxamide.
| Compound Name | 2-oxo-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 18121330 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-oxo-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]chromene-3-carboxamide |
| SMILES | CC(C)NS(=O)(=O)Cc1ccccc1CNC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C21H22N2O5S/c1-14(2)23-29(26,27)13-17-9-4-3-8-16(17)12-22-20(24)18-11-15-7-5-6-10-19(15)28-21(18)25/h3-11,14,23H,12-13H2,1-2H3,(H,22,24) |
| InChIKey | ZLOQYLDHSDMWKG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|