C18H23N3O4S — CID 55574430
1-methyl-2-oxo-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]pyridine-4-carboxamide (PubChem CID 55574430) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is 1-methyl-2-oxo-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]pyridine-4-carboxamide.
| Compound Name | 1-methyl-2-oxo-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55574430 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 1-methyl-2-oxo-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]pyridine-4-carboxamide |
| SMILES | CC(C)NS(=O)(=O)Cc1ccccc1CNC(=O)c1ccn(C)c(=O)c1 |
| InChI | InChI=1S/C18H23N3O4S/c1-13(2)20-26(24,25)12-16-7-5-4-6-15(16)11-19-18(23)14-8-9-21(3)17(22)10-14/h4-10,13,20H,11-12H2,1-3H3,(H,19,23) |
| InChIKey | LAVKWJZYQYBMQE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |