C23H26FN7O3S2 — CID 3457198
2-[[4-amino-5-[(2-fluorophenyl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide (PubChem CID 3457198) has the molecular formula C23H26FN7O3S2 and a molecular weight of 531.64 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2-fluorophenyl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[[4-amino-5-[(2-fluorophenyl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3457198 |
| Molecular Formula | C23H26FN7O3S2 |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 2-[[4-amino-5-[(2-fluorophenyl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide |
| SMILES | Nn1c(Cc2ccccc2F)nnc1SCC(=O)Nc1cccc(S(=O)(=O)NC2=NCCCCC2)c1 |
| InChI | InChI=1S/C23H26FN7O3S2/c24-19-10-4-3-7-16(19)13-21-28-29-23(31(21)25)35-15-22(32)27-17-8-6-9-18(14-17)36(33,34)30-20-11-2-1-5-12-26-20/h3-4,6-10,14H,1-2,5,11-13,15,25H2,(H,26,30)(H,27,32) |
| InChIKey | LDUINRXGQZXMPV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 144.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |