C12H13NO4 — CID 3458834
2-[(2-carboxycyclopropyl)amino]-6-methylbenzoic acid (PubChem CID 3458834) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-[(2-carboxycyclopropyl)amino]-6-methylbenzoic acid.
| Compound Name | 2-[(2-carboxycyclopropyl)amino]-6-methylbenzoic acid |
|---|---|
| PubChem CID | 3458834 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-[(2-carboxycyclopropyl)amino]-6-methylbenzoic acid |
| SMILES | Cc1cccc(NC2CC2C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C12H13NO4/c1-6-3-2-4-8(10(6)12(16)17)13-9-5-7(9)11(14)15/h2-4,7,9,13H,5H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | SFVZTDPWPUEMKS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |