C15H20BrNO2 — CID 114888288
2-bromo-6-[(3,5-dimethylcyclohexyl)amino]benzoic acid (PubChem CID 114888288) has the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. Its IUPAC name is 2-bromo-6-[(3,5-dimethylcyclohexyl)amino]benzoic acid.
| Compound Name | 2-bromo-6-[(3,5-dimethylcyclohexyl)amino]benzoic acid |
|---|---|
| PubChem CID | 114888288 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-bromo-6-[(3,5-dimethylcyclohexyl)amino]benzoic acid |
| SMILES | CC1CC(C)CC(Nc2cccc(Br)c2C(=O)O)C1 |
| InChI | InChI=1S/C15H20BrNO2/c1-9-6-10(2)8-11(7-9)17-13-5-3-4-12(16)14(13)15(18)19/h3-5,9-11,17H,6-8H2,1-2H3,(H,18,19) |
| InChIKey | QLEXQWMTTAJPNN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |