C18H14Br4N2O2 — CID 3459617
4,5,6,7-tetrabromo-2-[4-(diethylamino)phenyl]isoindole-1,3-dione (PubChem CID 3459617) has the molecular formula C18H14Br4N2O2 and a molecular weight of 609.94 g/mol. Its IUPAC name is 4,5,6,7-tetrabromo-2-[4-(diethylamino)phenyl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrabromo-2-[4-(diethylamino)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3459617 |
| Molecular Formula | C18H14Br4N2O2 |
| Molecular Weight | 609.94 g/mol |
| Exact Mass | 605.78 |
| IUPAC Name | 4,5,6,7-tetrabromo-2-[4-(diethylamino)phenyl]isoindole-1,3-dione |
| SMILES | CCN(CC)c1ccc(N2C(=O)c3c(Br)c(Br)c(Br)c(Br)c3C2=O)cc1 |
| InChI | InChI=1S/C18H14Br4N2O2/c1-3-23(4-2)9-5-7-10(8-6-9)24-17(25)11-12(18(24)26)14(20)16(22)15(21)13(11)19/h5-8H,3-4H2,1-2H3 |
| InChIKey | BEQLJHKGVHHNTE-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.94 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|