C39H47F3N2O6 — CID 3460900
1-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-propan-2-yl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea (PubChem CID 3460900) has the molecular formula C39H47F3N2O6 and a molecular weight of 696.81 g/mol. Its IUPAC name is 1-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-propan-2-yl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-propan-2-yl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 3460900 |
| Molecular Formula | C39H47F3N2O6 |
| Molecular Weight | 696.81 g/mol |
| Exact Mass | 696.34 |
| IUPAC Name | 1-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-propan-2-yl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2ccc(OC(F)(F)F)cc2)C(=O)NC(C)C)c2ccc(cc2C(=O)c2ccco2)CC(O)CC1 |
| InChI | InChI=1S/C39H47F3N2O6/c1-25(2)43-36(47)44(23-27-10-14-30(15-11-27)50-39(40,41)42)24-38(48)19-17-33-31-16-12-28(22-32(31)35(46)34-8-6-20-49-34)21-29(45)13-9-26(3)7-5-18-37(33,38)4/h6-8,10-12,14-16,20,22,25,29,33,45,48H,5,9,13,17-19,21,23-24H2,1-4H3,(H,43,47) |
| InChIKey | NTHQXOWUZWTHQY-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.81 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|