C17H19F2N3O3S — CID 3461193
N-[4-(difluoromethoxy)-2-methylphenyl]-2-(4-propoxypyrimidin-2-yl)sulfanylacetamide (PubChem CID 3461193) has the molecular formula C17H19F2N3O3S and a molecular weight of 383.42 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)-2-methylphenyl]-2-(4-propoxypyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[4-(difluoromethoxy)-2-methylphenyl]-2-(4-propoxypyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 3461193 |
| Molecular Formula | C17H19F2N3O3S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-[4-(difluoromethoxy)-2-methylphenyl]-2-(4-propoxypyrimidin-2-yl)sulfanylacetamide |
| SMILES | CCCOc1ccnc(SCC(=O)Nc2ccc(OC(F)F)cc2C)n1 |
| InChI | InChI=1S/C17H19F2N3O3S/c1-3-8-24-15-6-7-20-17(22-15)26-10-14(23)21-13-5-4-12(9-11(13)2)25-16(18)19/h4-7,9,16H,3,8,10H2,1-2H3,(H,21,23) |
| InChIKey | CBOVZMWPYOPVMS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |