C19H21N3O4S — CID 3462212
2-(2,5-dimethylphenoxy)-N-[[(2-phenoxyacetyl)amino]carbamothioyl]acetamide (PubChem CID 3462212) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-N-[[(2-phenoxyacetyl)amino]carbamothioyl]acetamide.
| Compound Name | 2-(2,5-dimethylphenoxy)-N-[[(2-phenoxyacetyl)amino]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3462212 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-N-[[(2-phenoxyacetyl)amino]carbamothioyl]acetamide |
| SMILES | Cc1ccc(C)c(OCC(=O)NC(=S)NNC(=O)COc2ccccc2)c1 |
| InChI | InChI=1S/C19H21N3O4S/c1-13-8-9-14(2)16(10-13)26-11-17(23)20-19(27)22-21-18(24)12-25-15-6-4-3-5-7-15/h3-10H,11-12H2,1-2H3,(H,21,24)(H2,20,22,23,27) |
| InChIKey | AWTUESRPIOKSCA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|