About N-[4,5-dimethyl-3-(pyrrolidin-1-ium-1-ylmethyl)thiophen-2-yl]-2-fluorobenzamide
N-[4,5-dimethyl-3-(pyrrolidin-1-ium-1-ylmethyl)thiophen-2-yl]-2-fluorobenzamide (PubChem CID 3462505) has the molecular formula C18H22FN2OS+
and a molecular weight of 333.45 g/mol. Its IUPAC name is N-[4,5-dimethyl-3-(pyrrolidin-1-ium-1-ylmethyl)thiophen-2-yl]-2-fluorobenzamide.
Molecular Properties
| Compound Name | N-[4,5-dimethyl-3-(pyrrolidin-1-ium-1-ylmethyl)thiophen-2-yl]-2-fluorobenzamide |
| PubChem CID | 3462505 |
| Molecular Formula | C18H22FN2OS+ |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N-[4,5-dimethyl-3-(pyrrolidin-1-ium-1-ylmethyl)thiophen-2-yl]-2-fluorobenzamide |
| SMILES | Cc1sc(NC(=O)c2ccccc2F)c(C[NH+]2CCCC2)c1C |
| InChI | InChI=1S/C18H21FN2OS/c1-12-13(2)23-18(15(12)11-21-9-5-6-10-21)20-17(22)14-7-3-4-8-16(14)19/h3-4,7-8H,5-6,9-11H2,1-2H3,(H,20,22)/p+1 |
| InChIKey | AQKKJKRCJURWMJ-UHFFFAOYSA-O |
| XLogP | 2.94 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[4,5-dimethyl-3-(pyrrolidin-1-ium-1-ylmethyl)thiophen-2-yl]-2-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4,5-dimethyl-3-(pyrrolidin-1-ium-1-ylmethyl)thiophen-2-yl]-2-fluorobenzamide?
The IUPAC name of N-[4,5-dimethyl-3-(pyrrolidin-1-ium-1-ylmethyl)thiophen-2-yl]-2-fluorobenzamide (CID 3462505) is N-[4,5-dimethyl-3-(pyrrolidin-1-ium-1-ylmethyl)thiophen-2-yl]-2-fluorobenzamide.
What is the SMILES notation for N-[4,5-dimethyl-3-(pyrrolidin-1-ium-1-ylmethyl)thiophen-2-yl]-2-fluorobenzamide?
The canonical SMILES for N-[4,5-dimethyl-3-(pyrrolidin-1-ium-1-ylmethyl)thiophen-2-yl]-2-fluorobenzamide is Cc1sc(NC(=O)c2ccccc2F)c(C[NH+]2CCCC2)c1C.
What is the InChIKey of N-[4,5-dimethyl-3-(pyrrolidin-1-ium-1-ylmethyl)thiophen-2-yl]-2-fluorobenzamide?
The InChIKey is AQKKJKRCJURWMJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H21FN2OS/c1-12-13(2)23-18(15(12)11-21-9-5-6-10-21)20-17(22)14-7-3-4-8-16(14)19/h3-4,7-8H,5-6,9-11H2,1-2H3,(H,20,22)/p+1.
What are the key properties of N-[4,5-dimethyl-3-(pyrrolidin-1-ium-1-ylmethyl)thiophen-2-yl]-2-fluorobenzamide?
N-[4,5-dimethyl-3-(pyrrolidin-1-ium-1-ylmethyl)thiophen-2-yl]-2-fluorobenzamide has a molecular weight of 333.45 g/mol, XLogP of 2.94, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4,5-dimethyl-3-(pyrrolidin-1-ium-1-ylmethyl)thiophen-2-yl]-2-fluorobenzamide is sourced from PubChem (CID 3462505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).