C45H58O6 — CID 3463309
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-[3-(2-methoxyphenyl)-4-oxochromen-7-yl]oxyacetate (PubChem CID 3463309) has the molecular formula C45H58O6 and a molecular weight of 694.95 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-[3-(2-methoxyphenyl)-4-oxochromen-7-yl]oxyacetate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-[3-(2-methoxyphenyl)-4-oxochromen-7-yl]oxyacetate |
|---|---|
| PubChem CID | 3463309 |
| Molecular Formula | C45H58O6 |
| Molecular Weight | 694.95 g/mol |
| Exact Mass | 694.42 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-[3-(2-methoxyphenyl)-4-oxochromen-7-yl]oxyacetate |
| SMILES | COc1ccccc1-c1coc2cc(OCC(=O)OC3CCC4(C)C(=CCC5C4CCC4(C)C(C(C)CCCC(C)C)CCC54)C3)ccc2c1=O |
| InChI | InChI=1S/C45H58O6/c1-28(2)10-9-11-29(3)37-18-19-38-34-16-14-30-24-32(20-22-44(30,4)39(34)21-23-45(37,38)5)51-42(46)27-49-31-15-17-35-41(25-31)50-26-36(43(35)47)33-12-7-8-13-40(33)48-6/h7-8,12-15,17,25-26,28-29,32,34,37-39H,9-11,16,18-24,27H2,1-6H3 |
| InChIKey | DGNGIKTWZPCLBK-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.95 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|