C15H12BrClN2O4 — CID 3468712
(2-bromo-4,5-dimethylphenyl) N-(4-chloro-2-nitrophenyl)carbamate (PubChem CID 3468712) has the molecular formula C15H12BrClN2O4 and a molecular weight of 399.63 g/mol. Its IUPAC name is (2-bromo-4,5-dimethylphenyl) N-(4-chloro-2-nitrophenyl)carbamate.
| Compound Name | (2-bromo-4,5-dimethylphenyl) N-(4-chloro-2-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 3468712 |
| Molecular Formula | C15H12BrClN2O4 |
| Molecular Weight | 399.63 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | (2-bromo-4,5-dimethylphenyl) N-(4-chloro-2-nitrophenyl)carbamate |
| SMILES | Cc1cc(Br)c(OC(=O)Nc2ccc(Cl)cc2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C15H12BrClN2O4/c1-8-5-11(16)14(6-9(8)2)23-15(20)18-12-4-3-10(17)7-13(12)19(21)22/h3-7H,1-2H3,(H,18,20) |
| InChIKey | VEMMFQPYSALWOT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|