C15H12BrF2NO2 — CID 4124456
(2-bromo-4,5-dimethylphenyl) N-(2,4-difluorophenyl)carbamate (PubChem CID 4124456) has the molecular formula C15H12BrF2NO2 and a molecular weight of 356.17 g/mol. Its IUPAC name is (2-bromo-4,5-dimethylphenyl) N-(2,4-difluorophenyl)carbamate.
| Compound Name | (2-bromo-4,5-dimethylphenyl) N-(2,4-difluorophenyl)carbamate |
|---|---|
| PubChem CID | 4124456 |
| Molecular Formula | C15H12BrF2NO2 |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | (2-bromo-4,5-dimethylphenyl) N-(2,4-difluorophenyl)carbamate |
| SMILES | Cc1cc(Br)c(OC(=O)Nc2ccc(F)cc2F)cc1C |
| InChI | InChI=1S/C15H12BrF2NO2/c1-8-5-11(16)14(6-9(8)2)21-15(20)19-13-4-3-10(17)7-12(13)18/h3-7H,1-2H3,(H,19,20) |
| InChIKey | DBMCASYVKHKLBS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |