C19H31N4O2P — CID 3468790
N-[bis(diethylamino)phosphoryl]-1-ethylindole-3-carboxamide (PubChem CID 3468790) has the molecular formula C19H31N4O2P and a molecular weight of 378.46 g/mol. Its IUPAC name is N-[bis(diethylamino)phosphoryl]-1-ethylindole-3-carboxamide.
| Compound Name | N-[bis(diethylamino)phosphoryl]-1-ethylindole-3-carboxamide |
|---|---|
| PubChem CID | 3468790 |
| Molecular Formula | C19H31N4O2P |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | N-[bis(diethylamino)phosphoryl]-1-ethylindole-3-carboxamide |
| SMILES | CCN(CC)P(=O)(NC(=O)c1cn(CC)c2ccccc12)N(CC)CC |
| InChI | InChI=1S/C19H31N4O2P/c1-6-21-15-17(16-13-11-12-14-18(16)21)19(24)20-26(25,22(7-2)8-3)23(9-4)10-5/h11-15H,6-10H2,1-5H3,(H,20,24,25) |
| InChIKey | XTJKLADFAIVNNS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|