C16H24NO3+ — CID 3468964
[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxopropyl]-diethyl-methylazanium (PubChem CID 3468964) has the molecular formula C16H24NO3+ and a molecular weight of 278.37 g/mol. Its IUPAC name is [3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxopropyl]-diethyl-methylazanium.
| Compound Name | [3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxopropyl]-diethyl-methylazanium |
|---|---|
| PubChem CID | 3468964 |
| Molecular Formula | C16H24NO3+ |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | [3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxopropyl]-diethyl-methylazanium |
| SMILES | CC[N+](C)(CC)CCC(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H24NO3/c1-4-17(3,5-2)9-8-14(18)13-6-7-15-16(12-13)20-11-10-19-15/h6-7,12H,4-5,8-11H2,1-3H3/q+1 |
| InChIKey | IXHDDZRDGJXGSA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|