C33H33N3O5S2 — CID 3472371
1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-(4-butoxy-3-methoxyphenyl)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione (PubChem CID 3472371) has the molecular formula C33H33N3O5S2 and a molecular weight of 615.78 g/mol. Its IUPAC name is 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-(4-butoxy-3-methoxyphenyl)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione.
| Compound Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-(4-butoxy-3-methoxyphenyl)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3472371 |
| Molecular Formula | C33H33N3O5S2 |
| Molecular Weight | 615.78 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | 1-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-5-(4-butoxy-3-methoxyphenyl)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
| SMILES | CCCCOc1ccc(C2C(=C(O)c3cc(C)ccc3C)C(=O)C(=O)N2c2nnc(SCc3ccccc3)s2)cc1OC |
| InChI | InChI=1S/C33H33N3O5S2/c1-5-6-16-41-25-15-14-23(18-26(25)40-4)28-27(29(37)24-17-20(2)12-13-21(24)3)30(38)31(39)36(28)32-34-35-33(43-32)42-19-22-10-8-7-9-11-22/h7-15,17-18,28,37H,5-6,16,19H2,1-4H3 |
| InChIKey | HIYSMQCSUCRYAF-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.78 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|