C20H23FN2O2S — CID 34733202
2-[3-(2-fluorophenyl)sulfanylpropanoylamino]-N-(2-methylpropyl)benzamide (PubChem CID 34733202) has the molecular formula C20H23FN2O2S and a molecular weight of 374.48 g/mol. Its IUPAC name is 2-[3-(2-fluorophenyl)sulfanylpropanoylamino]-N-(2-methylpropyl)benzamide.
| Compound Name | 2-[3-(2-fluorophenyl)sulfanylpropanoylamino]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 34733202 |
| Molecular Formula | C20H23FN2O2S |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[3-(2-fluorophenyl)sulfanylpropanoylamino]-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CNC(=O)c1ccccc1NC(=O)CCSc1ccccc1F |
| InChI | InChI=1S/C20H23FN2O2S/c1-14(2)13-22-20(25)15-7-3-5-9-17(15)23-19(24)11-12-26-18-10-6-4-8-16(18)21/h3-10,14H,11-13H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | BLIJCNKWOKUOCP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |