C18H19N3O4 — CID 34737309
(2S)-2-(4-cyanophenoxy)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-N-methylpropanamide (PubChem CID 34737309) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is (2S)-2-(4-cyanophenoxy)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-N-methylpropanamide.
| Compound Name | (2S)-2-(4-cyanophenoxy)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 34737309 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2S)-2-(4-cyanophenoxy)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-N-methylpropanamide |
| SMILES | C[C@H](Oc1ccc(C#N)cc1)C(=O)N(C)CC(=O)NCc1ccco1 |
| InChI | InChI=1S/C18H19N3O4/c1-13(25-15-7-5-14(10-19)6-8-15)18(23)21(2)12-17(22)20-11-16-4-3-9-24-16/h3-9,13H,11-12H2,1-2H3,(H,20,22)/t13-/m0/s1 |
| InChIKey | UMCDRNUQOSSXCE-ZDUSSCGKSA-N |
| XLogP | 1.69 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |