C19H16N2O3 — CID 86994457
N-(1-benzofuran-2-ylmethyl)-2-(4-cyanophenoxy)propanamide (PubChem CID 86994457) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is N-(1-benzofuran-2-ylmethyl)-2-(4-cyanophenoxy)propanamide.
| Compound Name | N-(1-benzofuran-2-ylmethyl)-2-(4-cyanophenoxy)propanamide |
|---|---|
| PubChem CID | 86994457 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-(1-benzofuran-2-ylmethyl)-2-(4-cyanophenoxy)propanamide |
| SMILES | CC(Oc1ccc(C#N)cc1)C(=O)NCc1cc2ccccc2o1 |
| InChI | InChI=1S/C19H16N2O3/c1-13(23-16-8-6-14(11-20)7-9-16)19(22)21-12-17-10-15-4-2-3-5-18(15)24-17/h2-10,13H,12H2,1H3,(H,21,22) |
| InChIKey | RXERTHADJQALNW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |