C24H29N3OS — CID 3475080
1-[2-(cyclohexen-1-yl)ethyl]-3-(2,2-diphenylpropanoylamino)thiourea (PubChem CID 3475080) has the molecular formula C24H29N3OS and a molecular weight of 407.58 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-(2,2-diphenylpropanoylamino)thiourea.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(2,2-diphenylpropanoylamino)thiourea |
|---|---|
| PubChem CID | 3475080 |
| Molecular Formula | C24H29N3OS |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(2,2-diphenylpropanoylamino)thiourea |
| SMILES | CC(C(=O)NNC(=S)NCCC1=CCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H29N3OS/c1-24(20-13-7-3-8-14-20,21-15-9-4-10-16-21)22(28)26-27-23(29)25-18-17-19-11-5-2-6-12-19/h3-4,7-11,13-16H,2,5-6,12,17-18H2,1H3,(H,26,28)(H2,25,27,29) |
| InChIKey | LFALKGQDBNTMPM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|