C18H15ClN2O4S — CID 34754518
N-[5-[(5-chloro-2-methoxyphenyl)carbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide (PubChem CID 34754518) has the molecular formula C18H15ClN2O4S and a molecular weight of 390.85 g/mol. Its IUPAC name is N-[5-[(5-chloro-2-methoxyphenyl)carbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[(5-chloro-2-methoxyphenyl)carbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 34754518 |
| Molecular Formula | C18H15ClN2O4S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | N-[5-[(5-chloro-2-methoxyphenyl)carbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)c1sc(NC(=O)c2ccco2)cc1C |
| InChI | InChI=1S/C18H15ClN2O4S/c1-10-8-15(21-17(22)14-4-3-7-25-14)26-16(10)18(23)20-12-9-11(19)5-6-13(12)24-2/h3-9H,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | PAUGNYOATJKPQA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |