C22H21ClN4O2 — CID 34755012
2-[[(E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]amino]-N-methylbenzamide (PubChem CID 34755012) has the molecular formula C22H21ClN4O2 and a molecular weight of 408.89 g/mol. Its IUPAC name is 2-[[(E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]amino]-N-methylbenzamide.
| Compound Name | 2-[[(E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 34755012 |
| Molecular Formula | C22H21ClN4O2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 2-[[(E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1NC(=O)/C=C/c1c(C)nn(Cc2ccccc2)c1Cl |
| InChI | InChI=1S/C22H21ClN4O2/c1-15-17(21(23)27(26-15)14-16-8-4-3-5-9-16)12-13-20(28)25-19-11-7-6-10-18(19)22(29)24-2/h3-13H,14H2,1-2H3,(H,24,29)(H,25,28)/b13-12+ |
| InChIKey | IMLYBVBJHCAKAE-OUKQBFOZSA-N |
| XLogP | 3.90 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|