C18H17ClN4OS — CID 26362369
(E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 26362369) has the molecular formula C18H17ClN4OS and a molecular weight of 372.88 g/mol. Its IUPAC name is (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 26362369 |
| Molecular Formula | C18H17ClN4OS |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | Cc1csc(NC(=O)/C=C/c2c(C)nn(Cc3ccccc3)c2Cl)n1 |
| InChI | InChI=1S/C18H17ClN4OS/c1-12-11-25-18(20-12)21-16(24)9-8-15-13(2)22-23(17(15)19)10-14-6-4-3-5-7-14/h3-9,11H,10H2,1-2H3,(H,20,21,24)/b9-8+ |
| InChIKey | CZOVZWLPBNUMQE-CMDGGOBGSA-N |
| XLogP | 4.31 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|