C24H28ClN4O+ — CID 8937229
[(2S)-2-[[(E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]amino]-2-phenylethyl]-dimethylazanium (PubChem CID 8937229) has the molecular formula C24H28ClN4O+ and a molecular weight of 423.97 g/mol. Its IUPAC name is [(2S)-2-[[(E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]amino]-2-phenylethyl]-dimethylazanium.
| Compound Name | [(2S)-2-[[(E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]amino]-2-phenylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8937229 |
| Molecular Formula | C24H28ClN4O+ |
| Molecular Weight | 423.97 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | [(2S)-2-[[(E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]amino]-2-phenylethyl]-dimethylazanium |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1/C=C/C(=O)N[C@H](C[NH+](C)C)c1ccccc1 |
| InChI | InChI=1S/C24H27ClN4O/c1-18-21(24(25)29(27-18)16-19-10-6-4-7-11-19)14-15-23(30)26-22(17-28(2)3)20-12-8-5-9-13-20/h4-15,22H,16-17H2,1-3H3,(H,26,30)/p+1/b15-14+/t22-/m1/s1 |
| InChIKey | OXOAJVRPWWLXEM-JXVRESAISA-O |
| XLogP | 2.91 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.97 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|