C18H21Cl2N3O — CID 55334914
(E)-N-butan-2-yl-3-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enamide (PubChem CID 55334914) has the molecular formula C18H21Cl2N3O and a molecular weight of 366.29 g/mol. Its IUPAC name is (E)-N-butan-2-yl-3-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-butan-2-yl-3-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55334914 |
| Molecular Formula | C18H21Cl2N3O |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | (E)-N-butan-2-yl-3-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]prop-2-enamide |
| SMILES | CCC(C)NC(=O)/C=C/c1c(C)nn(Cc2ccc(Cl)cc2)c1Cl |
| InChI | InChI=1S/C18H21Cl2N3O/c1-4-12(2)21-17(24)10-9-16-13(3)22-23(18(16)20)11-14-5-7-15(19)8-6-14/h5-10,12H,4,11H2,1-3H3,(H,21,24)/b10-9+ |
| InChIKey | DGJDEMXVNVHJIE-MDZDMXLPSA-N |
| XLogP | 4.47 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|