C21H20Cl2N4O — CID 39897463
(E)-3-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]-N-(2-pyridin-2-ylethyl)prop-2-enamide (PubChem CID 39897463) has the molecular formula C21H20Cl2N4O and a molecular weight of 415.32 g/mol. Its IUPAC name is (E)-3-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]-N-(2-pyridin-2-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]-N-(2-pyridin-2-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 39897463 |
| Molecular Formula | C21H20Cl2N4O |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (E)-3-[5-chloro-1-[(4-chlorophenyl)methyl]-3-methylpyrazol-4-yl]-N-(2-pyridin-2-ylethyl)prop-2-enamide |
| SMILES | Cc1nn(Cc2ccc(Cl)cc2)c(Cl)c1/C=C/C(=O)NCCc1ccccn1 |
| InChI | InChI=1S/C21H20Cl2N4O/c1-15-19(9-10-20(28)25-13-11-18-4-2-3-12-24-18)21(23)27(26-15)14-16-5-7-17(22)8-6-16/h2-10,12H,11,13-14H2,1H3,(H,25,28)/b10-9+ |
| InChIKey | TWCLKQYQODMVDF-MDZDMXLPSA-N |
| XLogP | 4.31 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|