C29H23NO4 — CID 3475859
(2-methyl-4,5-diphenacyl-3-pyridinyl) benzoate (PubChem CID 3475859) has the molecular formula C29H23NO4 and a molecular weight of 449.51 g/mol. Its IUPAC name is (2-methyl-4,5-diphenacyl-3-pyridinyl) benzoate.
| Compound Name | (2-methyl-4,5-diphenacyl-3-pyridinyl) benzoate |
|---|---|
| PubChem CID | 3475859 |
| Molecular Formula | C29H23NO4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (2-methyl-4,5-diphenacyl-3-pyridinyl) benzoate |
| SMILES | Cc1ncc(CC(=O)c2ccccc2)c(CC(=O)c2ccccc2)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H23NO4/c1-20-28(34-29(33)23-15-9-4-10-16-23)25(18-27(32)22-13-7-3-8-14-22)24(19-30-20)17-26(31)21-11-5-2-6-12-21/h2-16,19H,17-18H2,1H3 |
| InChIKey | ODJTWDJTUVWXBS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |