C27H28O4 — CID 87398377
(2-benzoyloxy-3,4-diethyl-6-propylphenyl) benzoate (PubChem CID 87398377) has the molecular formula C27H28O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is (2-benzoyloxy-3,4-diethyl-6-propylphenyl) benzoate.
| Compound Name | (2-benzoyloxy-3,4-diethyl-6-propylphenyl) benzoate |
|---|---|
| PubChem CID | 87398377 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (2-benzoyloxy-3,4-diethyl-6-propylphenyl) benzoate |
| SMILES | CCCc1cc(CC)c(CC)c(OC(=O)c2ccccc2)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H28O4/c1-4-13-22-18-19(5-2)23(6-3)25(31-27(29)21-16-11-8-12-17-21)24(22)30-26(28)20-14-9-7-10-15-20/h7-12,14-18H,4-6,13H2,1-3H3 |
| InChIKey | AZZQVPURFIFMQR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|